On Target AGTR2_HUMAN 0.29/CHEMBL290829
For the given ligand Acetaminophen, we have found in our database that, being scored 0.29, the most similar ligand is CHEMBL290829. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL290829 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | OC(=O)[C@@H]1CN(CCN1C(=O)N(c2ccccc2)c3ccccc3)C(=O)N(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00010016 00007000 00100000 04000e00 00000080 00000000 00000014 00002009 00002000 00020840 00280004 4000b000 0e00b002 00102001 00100040 00080008 30040010 00400001 08800012 00000200 40000100 38110e00 230220a1 02000018 00113003 00000000 02000000 00000080 08008000 00060001 20004000 00004200 |