On Target OPRD_HUMAN 0.43037975/CHEMBL416930
For the given ligand Acetaminophen, we have found in our database that, being scored 0.43037975, the most similar ligand is CHEMBL416930. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL416930 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCN(CC)C(=O)c1ccc(cc1)C(N2CCN(CC2)c3ccc(O)cc3)c4ccccc4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 00000808 20000120 44010600 00000000 00000000 02000000 03001000 00000100 00090a40 08200004 40008800 80008822 00002000 00000440 00000008 00040000 02000000 08000000 00020000 40100000 28028600 20000020 0240001e 00000000 e0000000 00040000 c0000080 08008180 00060003 80040000 00000600 |