On Target GRM4_HUMAN 0.39772728/CHEMBL3609733
For the given ligand Acetaminophen, we have found in our database that, being scored 0.39772728, the most similar ligand is CHEMBL3609733. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL3609733 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1cccc(NC(=O)c2ccccn2)c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 80200808 20004108 10000e00 10061020 00100000 02000000 02001001 00000000 00000840 00290004 4000c000 00008802 08100000 01020041 0204010c 00040080 02000000 08200000 00022400 40100000 08028600 20812000 00400004 00100000 80000001 00000040 80000080 00008304 00060001 80040000 00024200 |