On Target MC5R_HUMAN 0.26050422/CHEMBL3896315
For the given ligand Acetaminophen, we have found in our database that, being scored 0.26050422, the most similar ligand is CHEMBL3896315. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL3896315 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Cc1ccc(\C=C\C(=O)NC[C@H]2CCN(C(=O)[C@@H](CCN)N2)c3ccc4ccccc4c3)c(C)c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 100a4002 0000b400 00100120 04010600 20000001 00002000 80100080 20000408 01a00100 20400be0 00280004 4002b000 06008002 00312001 80020042 00000008 20040400 02000100 08018000 00801201 69100000 380c0608 20002003 0240001a 00000000 80000000 00482000 50010080 08408000 00060011 04004000 02002200 |