On Target GASR_HUMAN 0.044444446/CHEMBL346784
For the given ligand test, we have found in our database that, being scored 0.044444446, the most similar ligand is CHEMBL346784. Check out the elaboration below.
| test (Given Ligand) | CHEMBL346784 (Similar Ligand) |
|---|---|
| CCCCC | CCCCCN(CCCCC)C(=O)C(CCC(=O)N1CCCC1)NC(=O)Nc2ccc(Cl)cc2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00038006 01003000 00100000 04000e00 00000000 00000010 00000004 20002009 00200000 000208c0 00280004 4003b800 0600b016 00102000 00000040 00000000 00040010 00400000 08000000 00000201 40000100 38050720 20022001 02100018 00112000 00000000 00080000 10000080 08008000 00060001 20084000 02826200 |