On Target HRH2_HUMAN 0.0754717/CHEMBL418470
For the given ligand test, we have found in our database that, being scored 0.0754717, the most similar ligand is CHEMBL418470. Check out the elaboration below.
| test (Given Ligand) | CHEMBL418470 (Similar Ligand) |
|---|---|
| CCCCC | NCC[C@H]1C[C@H]1c2c[nH]cn2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 01000000 00000002 00800410 04000140 00000000 01002000 00000000 00500900 00080080 20008000 40010800 00000000 01100800 00020000 000c0004 00000000 06000000 00002008 40000001 00300400 10000010 21000000 00000010 00040000 00000200 00000000 00000080 00000006 00460000 40000000 20000000 |