On Target CCR2_HUMAN 0.057142857/CHEMBL2036772
For the given ligand test, we have found in our database that, being scored 0.057142857, the most similar ligand is CHEMBL2036772. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2036772 (Similar Ligand) |
|---|---|
| CCCCC | O=C(Nc1ccccc1)N2CCN(C[C@@H]3CCCN(C3)C4CC4)CC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000006 01002400 00100000 04000e00 00000000 00000000 00000004 20002009 00000000 000209e0 00280004 50018000 0000a002 01102000 00000040 00000000 00040010 00400000 08000000 00000201 40000100 38010420 20022021 02100018 00100000 00000000 00000000 10000080 08008000 00060011 00000000 00006200 |