On Target CXCR3_HUMAN 0.27631578/CHEMBL2181464
For the given ligand test, we have found in our database that, being scored 0.27631578, the most similar ligand is CHEMBL2181464. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2181464 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | [I-].Cc1ccccc1c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002010 01008001 00100100 00010600 00000000 00000000 00100000 22001402 00000100 001008c0 00200000 40018000 80020902 00210010 20000400 00000100 20020000 02000120 04002000 10000201 00000000 18008010 10008000 00500010 00200000 c0000000 00484200 90000040 00004100 00060000 24260000 00000200 |