On Target NPBW1_HUMAN 0.14503817/CHEMBL1991452
For the given ligand test, we have found in our database that, being scored 0.14503817, the most similar ligand is CHEMBL1991452. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1991452 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | COc1ccc(cc1)C2=C(Br)C=NN(Cc3cccc4ccccc34)C2=O |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000e004 42008608 20000188 00010610 20081046 00002008 02048000 00001000 06100000 800008c0 00100008 60018000 0000983a 08e00000 41060001 800d000c 08020048 82004000 04200000 00221801 00040000 1c018018 91800801 83720008 04104001 80000000 00068000 10041040 04004200 000e0009 00248008 0a000020 |