On Target EDNRA_HUMAN 0.33962265/CHEMBL170121
For the given ligand CAR, we have found in our database that, being scored 0.33962265, the most similar ligand is CHEMBL170121. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL170121 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00010002 01007a00 00100100 45810e10 00045280 00000000 00002004 2000200c 00400880 000b08c0 08300004 4001b000 1e00b802 00402801 80180040 080c000c 10000010 82800000 00202448 80000201 40000100 38258e18 22800003 9350001c 00053800 80000000 08000000 10000000 0c000000 0006000b 200c4200 00002620 |