On Target ADRB2_HUMAN 0.5495495/CHEMBL417709
For the given ligand CAR, we have found in our database that, being scored 0.5495495, the most similar ligand is CHEMBL417709. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL417709 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C1C2CCCCN2C(=O)N1CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00014002 01003000 40100120 04010e00 00000000 00000000 00000404 20002008 00200000 00000ad0 00200004 5003b004 0600900a 01002000 80000040 00000000 00040000 02002000 08002040 00000211 40120100 38050610 20000021 0250001a 00050000 80000000 00000000 90000080 08408000 00060001 20184000 00002200 |