On Target MC4R_HUMAN 0.4921875/CHEMBL197278
For the given ligand CAR, we have found in our database that, being scored 0.4921875, the most similar ligand is CHEMBL197278. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL197278 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(Cc1ccccc1)NCC1(N2CCN(C(=O)[C@@H](Cc3ccc(Cl)cc3)NC(=O)C3Cc4ccccc4N3)CC2)CCCCC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01003200 00100120 04010600 20000000 00000040 02000000 2010000c 00000880 00080ac0 08300004 4001b800 07008026 00002001 c0020140 00040000 00240000 02000000 0a002008 00000201 40100100 38240710 20000023 8350001b 00002800 80000080 00040000 10001080 0c008000 0006000b 20027000 20022600 |