On Target ADRB3_HUMAN 0.39449543/CHEMBL155072
For the given ligand CAR, we have found in our database that, being scored 0.39449543, the most similar ligand is CHEMBL155072. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL155072 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | C[C@H](CNc1ccccc1)NC[C@H](O)c1cccc(Cl)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 14000000 00100120 04010600 20000080 00004000 04000000 00000000 00000180 00080a40 08200004 40008800 02000006 00002000 80120040 00080008 10040000 02000000 08000000 00000200 40100000 38200120 22000001 83480012 00002000 80000000 00000000 00000080 0c008000 00060002 40000000 00020600 |