On Target ACM4_HUMAN 0.38016528/CHEMBL728
For the given ligand CAR, we have found in our database that, being scored 0.38016528, the most similar ligand is CHEMBL728. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL728 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00800600 00120000 05100600 20040000 08002000 08000010 00000000 00002000 00000960 00204004 60008800 02000006 00002001 20020040 00000002 04041000 20000000 08200002 02004200 e0100000 38000900 20800021 02080019 00006000 00000100 12200010 00000080 08008200 01060010 0000a000 00030220 |