On Target TAAR1_HUMAN 0.4117647/CHEMBL1391385
For the given ligand CAR, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL1391385. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1391385 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC1NC(=O)NC1CCCCCC(=O)NCCc1ccccc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00010000 01003000 00100100 00010e00 00000000 00000000 00000004 20002004 00000080 000808c0 08200000 40019000 0400900a 00000000 00000000 00000000 00000000 02002000 00002040 00000201 00000100 38250610 00000000 81500018 00010000 80000000 00000000 10000000 0c000000 00060003 000a0000 00002600 |