On Target NK1R_HUMAN 0.55172414/CHEMBL345866
For the given ligand CAR, we have found in our database that, being scored 0.55172414, the most similar ligand is CHEMBL345866. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL345866 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCCCCN(CCCCC)C(=O)[C@H]1CCN(C(=O)N(c2ccccc2)c2cccc(Cl)c2)[C@H](C(=O)NCCNCC(N)=O)C1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00038006 01003000 00100000 06000e00 00000000 00000000 08000014 20002009 00202000 000208c0 00280004 5003b800 0600b01e 00102001 80000040 00000000 00040010 00400000 08002002 00004201 40000100 38050f30 20022003 02100018 00112000 00000000 02000000 10000080 08008000 00060001 20084000 00826200 |