On Target AA1R_HUMAN 0.3043478/CHEMBL329774
For the given ligand CAR, we have found in our database that, being scored 0.3043478, the most similar ligand is CHEMBL329774. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL329774 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCCN1C(=O)C2NC(C3CCCC3)NC2N(CCCOC(=O)CBr)C1=O |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00010000 0300b400 00100100 04010e00 00000000 00000000 00000024 20002008 00000000 000201a0 06200002 4001b000 0f00b102 00082000 80000000 00080008 00220010 00802001 00802050 00000201 00020920 301b0e10 01000081 02100018 00013403 00000000 00000000 10000100 08000200 01040015 08184009 00002200 |