On Target CLTR1_HUMAN 0.23280424/CHEMBL3342954
For the given ligand CAR, we have found in our database that, being scored 0.23280424, the most similar ligand is CHEMBL3342954. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3342954 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(O)CCCCC(=O)N1CC(C(=O)O)Oc2c(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)cccc21 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 04016002 01005808 2010110b 00010702 a8081080 02002000 02040800 22001000 00020820 000808c0 083c0004 5001d000 0c80880a 00b00000 112a1041 00086408 10840000 86000001 08c02010 00020201 41100100 18168e10 37412080 0850801c 00081001 80100000 28a20448 90800081 00808300 00060003 80040400 00002600 |