On Target NPFF1_HUMAN 0.5289256/CHEMBL3361421
For the given ligand CAR, we have found in our database that, being scored 0.5289256, the most similar ligand is CHEMBL3361421. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3361421 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | N=C(N)NCC(=O)NCC1(Nc2ccc(Cl)c(Cl)c2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01003400 00100120 05010e00 20000000 00000000 08000000 22003008 00200440 00000be2 00200004 5003a800 0600a806 00002001 00020440 00100000 00050010 02000000 08000000 00004201 60100000 38058700 20000003 0250001a 00002000 c0100000 40080000 90000080 08008110 00060011 20044000 02020200 |