On Target GRM2_HUMAN 0.416/CHEMBL1097052
For the given ligand CAR, we have found in our database that, being scored 0.416, the most similar ligand is CHEMBL1097052. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1097052 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCCCCCC1CN(c2cccc(Cl)c2)C(=O)O1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01405000 00101300 05010700 20080080 0000a000 08000000 80000000 00000204 000008c0 002c0004 40018800 02008004 00900101 00021040 00180008 00868000 00800000 08402800 00404001 40100000 18040d50 33002002 00100018 00002000 00001002 18000000 10000080 00008200 80060003 80020000 00020200 |