On Target CNR2_HUMAN 0.51/CHEMBL2338177
For the given ligand CAR, we have found in our database that, being scored 0.51, the most similar ligand is CHEMBL2338177. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL2338177 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00014002 01002000 00100021 04000600 20000000 00002000 00000000 20100008 00000000 00000ac0 00282004 40019200 0400800a 00102000 00060040 00000000 00040000 00004000 0a002000 00000201 40100000 38000610 20002001 0210001a 00000000 00000000 00000020 10000080 08008000 02060001 00021000 00000200 |