On Target HRH4_HUMAN 0.53271025/CHEMBL1223683
For the given ligand CAR, we have found in our database that, being scored 0.53271025, the most similar ligand is CHEMBL1223683. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1223683 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Clc1cccc(N2CCN(CCCCNc3ccc4ccccc4n3)CC2)c1Cl |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00000000 00104020 05000600 20040000 00002000 08000000 28100000 00200000 20000ac0 00200004 40028800 02000806 00402001 00020040 00040004 00040000 10004000 08200000 00a04201 40100000 3c008108 20800821 82210012 00002000 00100400 00000080 10000080 08008008 00060800 00041000 00020200 |