On Target PTAFR_HUMAN 0.3773585/CHEMBL297624
For the given ligand CBD, we have found in our database that, being scored 0.3773585, the most similar ligand is CHEMBL297624. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL297624 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cc(cc(OC)c1OC)[C@H]2CC[C@@H](O2)c3cc(OC)c(OC)c(OC)c3 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000001 4b000008 2000010a 00010200 00081010 40004000 42040000 00000000 00000900 00080848 08100000 40008000 00004002 20210000 01080005 02088008 00000000 02000204 00482000 00020a01 00000120 08000020 01000000 00400010 00000400 80002000 005a0000 00000000 00000202 0002000a 40000000 02000400 |