On Target ACM5_HUMAN 0.40101522/CHEMBL2312378
For the given ligand sinomenine, we have found in our database that, being scored 0.40101522, the most similar ligand is CHEMBL2312378. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2312378 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCN1CCC(c2ccccc2)=C(C(=O)OCc2ccc3c(c2)OCO3)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00000010 48008208 20100108 00010600 00001010 00004800 821c0180 30000400 01a00900 005808c8 48300000 40009000 0c00c102 20090000 01000007 022c8008 20220400 02000140 2089801a 00820201 00040320 18000aa0 01008080 00400010 40001401 80002400 004a2000 70010420 01400200 0006040a 44000000 02012610 |