On Target GABR1_HUMAN 0.21287128/CHEMBL2391908
For the given ligand sinomenine, we have found in our database that, being scored 0.21287128, the most similar ligand is CHEMBL2391908. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2391908 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1.Cl |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00008008 0d000200 00100100 00010600 00000080 80000000 04000000 02001000 00000400 00080848 08200001 40108800 02000876 01060000 8e000400 00080008 1000002c 02300000 02006000 00000201 00000000 19108100 03400000 00480010 08002000 c0100000 00040000 80014000 00140b00 00060302 70060000 0102d601 |