On Target OPRK_HUMAN 0.71428573/CHEMBL110124
For the given ligand sinomenine, we have found in our database that, being scored 0.71428573, the most similar ligand is CHEMBL110124. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL110124 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc2c(c1O)[C@]13CCN(C)C(C2)[C@]12CCC(=O)[C@H]3/C(=C(\C)c1ccccc1)C2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010000 43000208 2010030a 00110600 00001020 c0000002 870400c0 20000601 100008c0 001808c2 08300000 50819040 0402c01a 20200000 01000423 0204a008 00004600 02000000 02092008 00020201 00000500 18200210 0000c020 81540010 01000800 80002001 04526000 d0001000 04400202 0106c00a 24020000 00012600 |