On Target ACM1_HUMAN 0.43678162/CHEMBL148450
For the given ligand sinomenine, we have found in our database that, being scored 0.43678162, the most similar ligand is CHEMBL148450. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL148450 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1cccc(CN2CCC(NC(=O)C(O)(c3ccccc3)C3CCCC3)CC2)c1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00010000 45001408 2010010a 00010600 00081080 00004000 02000000 22001000 00000980 000809e0 08300000 5001d000 0500880a 00a00000 41080401 00080008 10000000 02000000 00482000 00020201 00000100 18288630 03000000 81548018 00000000 c0000000 00000000 90000000 04000302 01060013 60062000 00002600 |