On Target MSHR_HUMAN 0.41284403/CHEMBL442537
For the given ligand sinomenine, we have found in our database that, being scored 0.41284403, the most similar ligand is CHEMBL442537. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL442537 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCCC(=O)NC1(C(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NCC(N)=O)CCc2c(cccc2OCC)C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04010002 43003a08 2010010a 45810e10 00041222 c0000002 03012000 2000020d 00700880 000908c2 08300014 4083b040 1e808812 20602889 81000061 020c200c 00000a00 02008000 00282408 00020201 40000100 38248628 20804003 93500418 00043800 c0000001 48010000 10000000 0c000302 0006c00b 20044200 00402620 |