On Target GRM1_HUMAN 0.36036035/CHEMBL2111944
For the given ligand sinomenine, we have found in our database that, being scored 0.36036035, the most similar ligand is CHEMBL2111944. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL2111944 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@]12C[C@H]1/C(=N\O)c1ccccc1O2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04012001 01005038 6390010a 00050f02 00481080 82001000 02000140 30006206 001109c0 000908c1 08350000 4001f040 0684800a 01200002 91281009 00082018 10820000 a2028000 00406008 00020201 00040100 18260e10 13000040 81500418 00000800 c0000000 40a00008 12000001 0404030b 00064003 60084000 00442601 |