On Target CXCR1_HUMAN 0.3125/CHEMBL220182
For the given ligand sinomenine, we have found in our database that, being scored 0.3125, the most similar ligand is CHEMBL220182. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL220182 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CC[C@@H](Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccc2c(c1)OCO2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 1040c002 46000808 6010010a 00012600 20011001 68022000 020400a0 22401500 05a00c40 001808d0 48380004 5042b000 0a00c802 20200000 81020441 1020e048 00050001 22008000 082b0210 20020201 48140b80 18128600 20000000 00448014 44041000 c0000080 20720010 b00c0580 21508302 20060003 a4045420 40012600 |