On Target 5HT1B_HUMAN 0.50955415/CHEMBL29951
For the given ligand sinomenine, we have found in our database that, being scored 0.50955415, the most similar ligand is CHEMBL29951. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL29951 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CCCN(CCC)C1CCc2cccc(OCCCCCCOc3cccc4c3CC(N(CCC)CCC)CC4)c2C1 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 04000000 43000208 2010010a 00010700 00081020 c2000000 02000000 20000201 00000880 000808c0 08300000 408080c0 00800002 20a00080 11000001 020c2008 90800200 22008000 00482000 00020201 00000100 18200000 01004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006400a 00000000 00002600 |