On Target AA3R_HUMAN 0.30927834/CHEMBL3601563
For the given ligand sinomenine, we have found in our database that, being scored 0.30927834, the most similar ligand is CHEMBL3601563. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3601563 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc2c([C@H]3CCc4ccc(Cl)cc43)nccc2c1OC |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 0000800a 05000008 2000410a 10010600 00041020 00080000 070c0410 01001001 00000800 000808cc 08108004 40808800 02004826 00601000 81020041 0206808c 00000000 06000001 00300008 00020201 40000100 18008108 20804000 80440010 00002000 a0000000 00160040 40000080 02000284 0082000a 00040000 20030400 |