On Target 5HT7R_HUMAN 0.47342995/CHEMBL70048
For the given ligand sinomenine, we have found in our database that, being scored 0.47342995, the most similar ligand is CHEMBL70048. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL70048 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc2c3c1CCCC3(CCCCN1CC=C(c3ccccc3)CC1)C(=O)N2 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00014012 4b008208 6050010a 00010600 24001020 c0002002 83180080 20000609 00400800 005808d8 08380024 40819040 0500812a 20310800 41020163 00042008 20048600 02000140 0808200a 00820201 44100100 18200610 2000e000 81500411 00040000 c0000301 004c2010 50011080 04408302 0006440b 04022080 22002600 |