On Target 5HT4R_HUMAN 0.40331492/CHEMBL4580044
For the given ligand sinomenine, we have found in our database that, being scored 0.40331492, the most similar ligand is CHEMBL4580044. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL4580044 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | COc1ccc(CN2CCC(CCC(=O)c3cc(Cl)c(N)cc3OC)CC2)cc1O |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00018002 c5000808 2010010a c0010600 00001000 00020000 06040000 22001200 00000800 000808c0 08300004 50019840 0600c80e 08200000 81000441 0000a008 00000000 02000400 00002000 00020601 40000100 18028310 20000000 00540414 00002000 c0000400 00320800 90000000 00000302 00064802 a0060000 00020600 |