On Target MC5R_HUMAN 0.41361257/CHEMBL3919100
For the given ligand sinomenine, we have found in our database that, being scored 0.41361257, the most similar ligand is CHEMBL3919100. Check out the elaboration below.
| sinomenine (Given Ligand) | CHEMBL3919100 (Similar Ligand) |
|---|---|
| CO/C4=C/C2C3Cc1ccc(OC)c(O)c1[C@]2(CCN3C)CC4=O | CC1(C)N[C@H](C(=O)NC[C@@H]2CCN(CC(c3ccccc3)c3ccccc3)C(=O)[C@H](CCCCN)N2)Cc2cc(O)ccc21 |
|
|
|
|
|
|
| 00010000 4b000208 2010010a 00110700 00081020 c0000002 070c0180 20000603 01000880 001888ca 08300000 5181d040 8402c01a 20a00000 03000421 020ca008 20800200 82000060 00492008 00020201 00000100 18200290 0100c000 81540010 00200800 80002001 04524000 90000180 04004202 0006c40a 2c020000 00012600 | 00018008 43003608 20100100 14010600 00000020 c0000002 03000000 2300100d 00200880 000909e0 08300000 4083b000 0600880a 00202001 80000400 02040008 00000000 02000020 00002008 00020201 08020100 382c8630 00004003 83500018 00000800 e0000001 00324000 d0000000 0c000180 0086001b 20044000 00002600 |