On Target MC4R_HUMAN 0.3617021/CHEMBL578944
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.3617021, the most similar ligand is CHEMBL578944. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL578944 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CCC(C)(C)c1ccc(OCCCC[n+]2cccc(C)c2C)c(C(C)(C)CC)c1.[Br-] |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000002 00000008 20104108 10010710 00141021 82000000 02040000 00000200 00000800 000808c0 08100004 40018040 00800802 00200000 11020001 020c200c 00000000 a2008004 08600000 00020001 40000100 18008010 21800000 00500410 00040000 c0000000 08120240 10800000 00400304 00060042 00000008 00000400 |