On Target AA1R_HUMAN 0.35403726/CHEMBL1269107
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.35403726, the most similar ligand is CHEMBL1269107. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL1269107 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CC1=C(C2=C(C)C(=O)c3c(cc(O)c(O)c3Cc3ccccc3)C2=O)C(=O)c2cc(O)c(O)c(Cc3ccccc3)c2C1=O |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00010000 43040c08 20800103 00310200 40000001 40808003 220004c1 01000603 81000840 00980a42 08100000 40009200 04028022 20200000 00000022 2808a00c 00000004 02100000 00392080 00030a01 00400100 080202c0 0100c000 00460014 00200000 a4000001 00520000 c0800000 02000082 00020002 86000000 00410400 |