On Target NPY5R_HUMAN 0.61538464/CHEMBL469257
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.61538464, the most similar ligand is CHEMBL469257. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL469257 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CCc1ccc2c(c1)OC1=C(C(=O)CC(C)(C)C1)C2C1=C(O)CC(C)(C)CC1=O |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04010002 43000008 2000010a 0001030a 00081800 82800000 06000081 00000602 01040908 009a8840 08900000 40009840 8482802a 20a00080 13000401 00083408 00800600 22108020 006d2008 0a020a01 00000101 18000288 01008000 0c480c10 00600800 c0000000 00405040 80000000 00004302 8002400a 24060000 00000400 |