On Target NPFF1_HUMAN 0.23428571/CHEMBL2208334
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.23428571, the most similar ligand is CHEMBL2208334. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL2208334 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | COc1cccc(C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(N)=O)c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00018000 45003a08 20100108 04010e00 00001000 00000000 02000000 2200300c 00200a80 000908c2 08300000 4003b000 06009812 00002001 81004401 20100008 00000000 02000000 00080008 00020201 00000100 38278620 00000003 8354801c 00000800 c0000000 40000000 90000000 0c000310 0006000b a00c4000 00002600 |