On Target GRM4_HUMAN 0.30917874/CHEMBL2063423
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.30917874, the most similar ligand is CHEMBL2063423. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL2063423 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | O=C(Nc1ccccn1)[C@]12C[C@H]1/C(=N\O)c1ccccc1O2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04016003 01000038 6398710a 00050f02 204c1080 82003000 02000140 10106202 00110940 200908c1 083d0004 4001d040 0484980a 01300000 11021009 000c201c 00840000 a202c000 08606000 00a20001 40140100 1c068610 33802840 00700410 00000000 c0000000 48200088 12000080 0004830b 00064803 40081000 00440701 |