On Target 5HT7R_HUMAN 0.48672566/CHEMBL4513930
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.48672566, the most similar ligand is CHEMBL4513930. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL4513930 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CC[C@H]1c2c(ccc3ccccc23)OC[C@@]1(C)N |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000000 01000018 20000108 00010702 00081000 82000000 02000000 00000200 00000800 000808c0 08100000 400080c0 00800002 00000000 11001001 00082008 10800000 22028000 00400000 00020001 00000100 18040008 03000040 81400410 00000000 c0000000 00000000 00000000 04000300 00060002 00000000 00000400 |