On Target HRH2_HUMAN 0.34136546/CHEMBL4452406
For the given ligand Trequinsin, we have found in our database that, being scored 0.34136546, the most similar ligand is CHEMBL4452406. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4452406 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1cccc(-c2nc(N)nc3c2CCCC3C)c1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000a002 41000809 a000018a 40850610 05021104 00004002 03002000 00080001 00400900 000c0840 20108004 6000a800 0a000002 00300800 21020021 000c000c 00020240 06003000 04482008 40223201 00100400 0c020000 b5806840 00400118 00842000 81000281 00000000 000000e1 0000420e 00460002 40401800 200000a0 |