On Target CCR5_HUMAN 0.34220532/CHEMBL443106
For the given ligand Trequinsin, we have found in our database that, being scored 0.34220532, the most similar ligand is CHEMBL443106. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL443106 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1nc2ccccc2n1[C@@H]1C[C@@H]2CC[C@H](C1)N2CCC1(c2ccccc2)CCN(C(C(=O)O)c2ccc3c(c2)OCO3)CC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000002 47000608 20100108 10010600 000c10e1 00004010 02040000 22001000 00200900 000819c0 4930800c 5001b000 0300d802 21c40000 c10e04c1 022c800c 18100000 02000000 00682000 00020201 c0040300 18008a30 23800001 00548010 40000000 c0000000 00320004 b0011000 01000304 0046081a 600e6000 00012680 |