On Target MC4R_HUMAN 0.3320158/CHEMBL232973
For the given ligand Trequinsin, we have found in our database that, being scored 0.3320158, the most similar ligand is CHEMBL232973. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL232973 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(-c2nc3ccc(C(=O)N(CCC(C)C)CCC(C)C)cc3n2CCCN2CCCCC2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00004002 01009c08 20100108 10050600 200c1060 00006000 02040000 22081004 00200100 100019c0 0120800c 50018000 00009822 01c48000 010204c1 020c000c 00100008 02802004 00600000 00420201 c0100000 38068630 21800001 0050001c 00004000 c0000000 00020044 90000000 00400304 00460c11 e00c8800 000022a0 |