On Target ADRB3_HUMAN 0.3465704/CHEMBL1088076
For the given ligand Trequinsin, we have found in our database that, being scored 0.3465704, the most similar ligand is CHEMBL1088076. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL1088076 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | O=C(Cn1ncc(-c2ccccc2)c1-c1ccccc1)Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00006006 41004809 a01041a0 41010612 210c1080 0000610a 00442000 00000000 00600180 00090ac0 082c008c 6001a000 00009812 00b08000 200a0840 840c200c 10064040 c2400004 0ce80400 00221200 60100000 38258660 33802881 9340401e 08050001 c0000000 18020008 100000e0 0c44c404 00060013 c0000240 00002620 |