On Target MC3R_HUMAN 0.31800765/CHEMBL392092
For the given ligand Trequinsin, we have found in our database that, being scored 0.31800765, the most similar ligand is CHEMBL392092. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL392092 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(C(=O)c2nc3ccc(C(=O)N(CCC(C)C)CCC(C)C)cc3n2CCCN2CCCCC2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000000a 01009c08 20100509 10050600 000c1060 00084000 02040000 22001004 00200100 100819c0 0928800c 50818000 00009802 01d48000 010204c1 020c008c 00100008 02800005 00600000 00020201 c0000000 18068630 21806001 0050041c 00004000 c0000000 00120044 90000000 00400304 00460813 e00c8000 200026a0 |