On Target GRM5_HUMAN 0.35815603/CHEMBL2431419
For the given ligand Trequinsin, we have found in our database that, being scored 0.35815603, the most similar ligand is CHEMBL2431419. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL2431419 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CN1CCOc2cc(-c3cn(CC(=O)N4CCN(c5ncccn5)CC4)c(-c4ccccc4)n3)ccc21 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0400e002 40002c08 20101108 54810612 a01810c0 00006108 02002200 00080048 00200100 300018d0 0025900c 4000a800 02809002 0118a080 010218c1 881c400c 00064080 c2006000 0c480000 40e23200 c1100000 3e060620 b3c02862 0240800e 00040001 c0080000 28000200 100010c0 0805c61d 00660811 40081860 00000a88 |