On Target ADA2A_HUMAN 0.37209302/CHEMBL302021
For the given ligand Trequinsin, we have found in our database that, being scored 0.37209302, the most similar ligand is CHEMBL302021. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL302021 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccccc1N1CCN(CC2CN3C(=O)Nc4ccccc4C3=N2)CC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00004002 00000408 241010ec 45410700 801c10c0 01004080 02000000 00000000 05200301 80000fe0 0520300c 40038000 00009002 01c42000 017408c1 000c400c 98160800 00100000 08e10000 00020201 c0100040 380000b8 23800163 12208012 38020080 40008000 60090000 00000180 088c8210 00460010 40080800 00000284 |