On Target CXCR1_HUMAN 0.24829932/CHEMBL490688
For the given ligand Trequinsin, we have found in our database that, being scored 0.24829932, the most similar ligand is CHEMBL490688. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL490688 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c2ccc3c(c2)OCCO3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 14010002 46010888 20100109 01210e20 20001000 48020010 02040210 0a101600 00803900 00080851 88352004 4000c880 0a80c812 20100081 01240041 100ce00c 00040000 1a005000 08080012 10024201 41100100 18228f00 25010010 08458015 00840002 80800480 20320000 80800090 20408308 1006000b c6041000 00010600 |