On Target HRH4_HUMAN 0.32089552/CHEMBL502347
For the given ligand Trequinsin, we have found in our database that, being scored 0.32089552, the most similar ligand is CHEMBL502347. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL502347 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Nc1nc2c(c(N3CC[C@@H](N)C3)n1)CCCc1ccccc1-2 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0001b002 01000801 c01001a2 088d0610 2302010c 00016050 0100a001 00180800 00400900 00080bd0 28308004 6000b800 07000002 00300800 a0020020 000e8006 00268800 06006000 04400008 40200001 20100100 3e060000 30806840 02400118 00840000 80080001 00000200 100050e0 0808401c 00460012 40001880 200006e0 |